Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 3934 | 3318 | None | 0 | Human | Functional | pEC50 | = | 11.1 | 11.1 | -6 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | ||
| 4356 | 3318 | None | 0 | Human | Functional | pEC50 | = | 11.1 | 11.1 | -6 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | ||
| 73755062 | 3318 | None | 0 | Human | Functional | pEC50 | = | 11.1 | 11.1 | -6 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | ||
| 5555 | 3417 | None | 0 | Human | Functional | pEC50 | = | 11.3 | 11.3 | -1 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 390 | 14 | 3 | 5 | 3.6 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](C/C=C\CCC(=O)OC)O)O)O | 22449948 | ||
| 71519431 | 3417 | None | 0 | Human | Functional | pEC50 | = | 11.3 | 11.3 | -1 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 390 | 14 | 3 | 5 | 3.6 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](C/C=C\CCC(=O)OC)O)O)O | 22449948 | ||
| 1034 | 2392 | None | 22 | Human | Functional | pEC50 | = | 9.7 | 9.7 | 10 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 352 | 14 | 4 | 4 | 3.1 | CCCCC[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)O)O | 20080636 | ||
| 5280914 | 2392 | None | 22 | Human | Functional | pEC50 | = | 9.7 | 9.7 | 10 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 352 | 14 | 4 | 4 | 3.1 | CCCCC[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)O)O | 20080636 | ||
| CHEMBL392438 | 2392 | None | 22 | Human | Functional | pEC50 | = | 9.7 | 9.7 | 10 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 352 | 14 | 4 | 4 | 3.1 | CCCCC[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)O)O | 20080636 | ||
Showing 1 to 8 of 8 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 3934 | 3318 | None | 0 | Human | Binding | pKd | = | 9.7 | 9.7 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | ||
| 4356 | 3318 | None | 0 | Human | Binding | pKd | = | 9.7 | 9.7 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | ||
| 73755062 | 3318 | None | 0 | Human | Binding | pKd | = | 9.7 | 9.7 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | ||
Showing 1 to 3 of 3 entries