Ligand source activities (1 row/activity)
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
AssayType |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
56707820 | 9685 | 39 | None | - | 1 | Human | 6.8 | pEC50 | = | 6.8 | Functional | ChEMBL | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 10.6019/CHEMBL5209897 | ||
9155 | 9685 | 39 | None | - | 1 | Human | 6.8 | pEC50 | = | 6.8 | Functional | ChEMBL | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 10.6019/CHEMBL5209897 | ||
CHEMBL4548689 | 9685 | 39 | None | - | 1 | Human | 6.8 | pEC50 | = | 6.8 | Functional | ChEMBL | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 10.6019/CHEMBL5209897 | ||
10572 | 9922 | 0 | None | - | 1 | Human | 5.9 | pEC50 | = | 5.9 | Functional | Guide to Pharmacology | None | None | None | None | 31675498 | ||||
145996515 | 9922 | 0 | None | - | 1 | Human | 5.9 | pEC50 | = | 5.9 | Functional | Guide to Pharmacology | None | None | None | None | 31675498 | ||||
10571 | 7589 | 0 | None | - | 1 | Human | 6.0 | pEC50 | = | 6.0 | Functional | Guide to Pharmacology | None | None | None | None | 31675498 | ||||
145996514 | 7589 | 0 | None | - | 1 | Human | 6.0 | pEC50 | = | 6.0 | Functional | Guide to Pharmacology | None | None | None | None | 31675498 | ||||
10570 | 9745 | 0 | None | - | 1 | Human | 6.4 | pEC50 | = | 6.4 | Functional | Guide to Pharmacology | None | None | None | None | 31675498 | ||||
145996513 | 9745 | 0 | None | - | 1 | Human | 6.4 | pEC50 | = | 6.4 | Functional | Guide to Pharmacology | None | None | None | None | 31675498 | ||||
56707820 | 9685 | 39 | None | - | 1 | Human | 5.0 | pKB | = | 5.0 | Functional | Guide to Pharmacology | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 26550826 | ||
9155 | 9685 | 39 | None | - | 1 | Human | 5.0 | pKB | = | 5.0 | Functional | Guide to Pharmacology | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 26550826 | ||
CHEMBL4548689 | 9685 | 39 | None | - | 1 | Human | 5.0 | pKB | = | 5.0 | Functional | Guide to Pharmacology | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 26550826 | ||
10440 | 9458 | 20 | None | -4 | 3 | Human | 5.9 | pKB | = | 5.9 | Functional | Guide to Pharmacology | 417 | 7 | 3 | 7 | 4.2 | OCc1cccc(c1c1nc(NCc2ccc(cc2)Oc2ccccc2)nc(n1)N)F | 31298539 | ||
139030523 | 9458 | 20 | None | -4 | 3 | Human | 5.9 | pKB | = | 5.9 | Functional | Guide to Pharmacology | 417 | 7 | 3 | 7 | 4.2 | OCc1cccc(c1c1nc(NCc2ccc(cc2)Oc2ccccc2)nc(n1)N)F | 31298539 | ||
CHEMBL4449712 | 9458 | 20 | None | -4 | 3 | Human | 5.9 | pKB | = | 5.9 | Functional | Guide to Pharmacology | 417 | 7 | 3 | 7 | 4.2 | OCc1cccc(c1c1nc(NCc2ccc(cc2)Oc2ccccc2)nc(n1)N)F | 31298539 |
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Similar- ity |
Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
Assay Type |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |