Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
AssayType |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
| 10321 | 1705 | 0 | None | - | 1 | Human | 6.4 | pEC50 | = | 6.4 | Functional | Guide to Pharmacology | 322 | 3 | 4 | 3 | 3.9 | O=C(Nc1ccc2c(c1)cccc2)Nc1cc(O)cc(c1)C(=O)O | 29293331 | ||
| 137553171 | 1705 | 0 | None | - | 1 | Human | 6.4 | pEC50 | = | 6.4 | Functional | Guide to Pharmacology | 322 | 3 | 4 | 3 | 3.9 | O=C(Nc1ccc2c(c1)cccc2)Nc1cc(O)cc(c1)C(=O)O | 29293331 | ||
| 10321 | 1705 | 0 | None | - | 1 | Human | 6.7 | pIC50 | = | 6.7 | Functional | Guide to Pharmacology | 322 | 3 | 4 | 3 | 3.9 | O=C(Nc1ccc2c(c1)cccc2)Nc1cc(O)cc(c1)C(=O)O | 25751279 | ||
| 137553171 | 1705 | 0 | None | - | 1 | Human | 6.7 | pIC50 | = | 6.7 | Functional | Guide to Pharmacology | 322 | 3 | 4 | 3 | 3.9 | O=C(Nc1ccc2c(c1)cccc2)Nc1cc(O)cc(c1)C(=O)O | 25751279 | ||
| 10322 | 1704 | 0 | None | - | 1 | Human | 6.2 | pIC50 | = | 6.2 | Functional | Guide to Pharmacology | 360 | 3 | 3 | 3 | 5.9 | O=C(Nc1ccc2c(c1)cccc2)Nc1cc(O)cc(c1)c1cccs1 | 25751279 | ||
| 10322 | 1704 | 0 | None | - | 1 | Human | 6.2 | pIC50 | = | 6.2 | Functional | Guide to Pharmacology | 360 | 3 | 3 | 3 | 5.9 | O=C(Nc1ccc2c(c1)cccc2)Nc1cc(O)cc(c1)c1cccs1 | 29293331 | ||
| 90478321 | 1704 | 0 | None | - | 1 | Human | 6.2 | pIC50 | = | 6.2 | Functional | Guide to Pharmacology | 360 | 3 | 3 | 3 | 5.9 | O=C(Nc1ccc2c(c1)cccc2)Nc1cc(O)cc(c1)c1cccs1 | 25751279 | ||
| 90478321 | 1704 | 0 | None | - | 1 | Human | 6.2 | pIC50 | = | 6.2 | Functional | Guide to Pharmacology | 360 | 3 | 3 | 3 | 5.9 | O=C(Nc1ccc2c(c1)cccc2)Nc1cc(O)cc(c1)c1cccs1 | 29293331 | ||
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Similar- ity |
Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
Assay Type |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
| 2947 | 2865 | 0 | None | - | 1 | Mouse | 8.4 | pKd | None | 8.4 | Binding | Guide to Pharmacology | None | None | None | None | 15035989 | |||||