Ligand source activities (1 row/activity)
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| #Vendors | Reference ligand
| Fold selectivity | # Tested GPCRs | Species
| p-value (-log) | Activity Type
| Activity Relation
| Activity Value
| AssayType
| Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
|
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Assay information
| Chemical information
| ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| #Vendors | Reference ligand
| Fold selectivity | # Tested GPCRs | Species
| p-value (-log) | Activity Type
| Activity Relation
| Activity Value
| AssayType
| Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
|
1499 | 2091 | 47 | None | -63 | 38 | Human | 8.3 | pEC50 | = | 8.3 | Functional | Agonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assayAgonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assay |
ChEMBL | 211 | 4 | 4 | 4 | 1.1 | CC(NCC(c1ccc(c(c1)O)O)O)C | nan | |
3779 | 2091 | 47 | None | -63 | 38 | Human | 8.3 | pEC50 | = | 8.3 | Functional | Agonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assayAgonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assay |
ChEMBL | 211 | 4 | 4 | 4 | 1.1 | CC(NCC(c1ccc(c(c1)O)O)O)C | nan | |
536 | 2091 | 47 | None | -63 | 38 | Human | 8.3 | pEC50 | = | 8.3 | Functional | Agonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assayAgonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assay |
ChEMBL | 211 | 4 | 4 | 4 | 1.1 | CC(NCC(c1ccc(c(c1)O)O)O)C | nan | |
CHEMBL434 | 2091 | 47 | None | -63 | 38 | Human | 8.3 | pEC50 | = | 8.3 | Functional | Agonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assayAgonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assay |
ChEMBL | 211 | 4 | 4 | 4 | 1.1 | CC(NCC(c1ccc(c(c1)O)O)O)C | nan | |
DB01064 | 2091 | 47 | None | -63 | 38 | Human | 8.3 | pEC50 | = | 8.3 | Functional | Agonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assayAgonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assay |
ChEMBL | 211 | 4 | 4 | 4 | 1.1 | CC(NCC(c1ccc(c(c1)O)O)O)C | nan | |
1499 | 2091 | 47 | None | -63 | 38 | Human | 8.1 | pEC50 | = | 8.1 | Functional | Agonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assayAgonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assay |
Drug Central | 211 | 4 | 4 | 4 | 1.1 | CC(NCC(c1ccc(c(c1)O)O)O)C | None | |
3779 | 2091 | 47 | None | -63 | 38 | Human | 8.1 | pEC50 | = | 8.1 | Functional | Agonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assayAgonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assay |
Drug Central | 211 | 4 | 4 | 4 | 1.1 | CC(NCC(c1ccc(c(c1)O)O)O)C | None | |
536 | 2091 | 47 | None | -63 | 38 | Human | 8.1 | pEC50 | = | 8.1 | Functional | Agonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assayAgonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assay |
Drug Central | 211 | 4 | 4 | 4 | 1.1 | CC(NCC(c1ccc(c(c1)O)O)O)C | None | |
CHEMBL434 | 2091 | 47 | None | -63 | 38 | Human | 8.1 | pEC50 | = | 8.1 | Functional | Agonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assayAgonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assay |
Drug Central | 211 | 4 | 4 | 4 | 1.1 | CC(NCC(c1ccc(c(c1)O)O)O)C | None | |
DB01064 | 2091 | 47 | None | -63 | 38 | Human | 8.1 | pEC50 | = | 8.1 | Functional | Agonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assayAgonist activity at human TAS2R39 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assay |
Drug Central | 211 | 4 | 4 | 4 | 1.1 | CC(NCC(c1ccc(c(c1)O)O)O)C | None | |
1183 | 3971 | 0 | None | -1 | 3 | Human | 3.1 | pEC50 | = | 3.1 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 152 | 2 | 1 | 3 | 1.2 | COc1cc(C=O)ccc1O | 34307435 | |
6412 | 3971 | 0 | None | -1 | 3 | Human | 3.1 | pEC50 | = | 3.1 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 152 | 2 | 1 | 3 | 1.2 | COc1cc(C=O)ccc1O | 34307435 | |
CHEMBL13883 | 3971 | 0 | None | -1 | 3 | Human | 3.1 | pEC50 | = | 3.1 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 152 | 2 | 1 | 3 | 1.2 | COc1cc(C=O)ccc1O | 34307435 | |
12497 | 1572 | 101 | None | -13 | 2 | Human | 3.4 | pEC50 | = | 3.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 290 | 1 | 5 | 6 | 1.5 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O | 21272567 | |
72276 | 1572 | 101 | None | -13 | 2 | Human | 3.4 | pEC50 | = | 3.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 290 | 1 | 5 | 6 | 1.5 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O | 21272567 | |
CHEMBL583912 | 1572 | 101 | None | -13 | 2 | Human | 3.4 | pEC50 | = | 3.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 290 | 1 | 5 | 6 | 1.5 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O | 21272567 | |
DB12039 | 1572 | 101 | None | -13 | 2 | Human | 3.4 | pEC50 | = | 3.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 290 | 1 | 5 | 6 | 1.5 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O | 21272567 | |
12461 | 1574 | 82 | None | - | 1 | Human | 3.4 | pEC50 | = | 3.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 306 | 1 | 6 | 7 | 1.3 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)O | 21272567 | |
72277 | 1574 | 82 | None | - | 1 | Human | 3.4 | pEC50 | = | 3.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 306 | 1 | 6 | 7 | 1.3 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)O | 21272567 | |
CHEMBL47386 | 1574 | 82 | None | - | 1 | Human | 3.4 | pEC50 | = | 3.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 306 | 1 | 6 | 7 | 1.3 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)O | 21272567 | |
DB03823 | 1574 | 82 | None | - | 1 | Human | 3.4 | pEC50 | = | 3.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 306 | 1 | 6 | 7 | 1.3 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)O | 21272567 | |
12441 | 3140 | 0 | None | -1 | 2 | Human | 4.3 | pEC50 | = | 4.3 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 242 | 1 | 2 | 3 | 2.8 | C1C(COC2=C1C=CC(=C2)O)C3=CC=C(C=C3)O | 21942422 | |
382975 | 3140 | 0 | None | -1 | 2 | Human | 4.3 | pEC50 | = | 4.3 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 242 | 1 | 2 | 3 | 2.8 | C1C(COC2=C1C=CC(=C2)O)C3=CC=C(C=C3)O | 21942422 | |
CHEMBL1957037 | 3140 | 0 | None | -1 | 2 | Human | 4.3 | pEC50 | = | 4.3 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 242 | 1 | 2 | 3 | 2.8 | C1C(COC2=C1C=CC(=C2)O)C3=CC=C(C=C3)O | 21942422 | |
2826 | 1784 | 137 | None | -48 | 7 | Human | 4.3 | pEC50 | = | 4.3 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 270 | 1 | 3 | 5 | 2.6 | Oc1ccc(cc1)c1coc2c(c1=O)c(O)cc(c2)O | 21942422 | |
5280961 | 1784 | 137 | None | -48 | 7 | Human | 4.3 | pEC50 | = | 4.3 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 270 | 1 | 3 | 5 | 2.6 | Oc1ccc(cc1)c1coc2c(c1=O)c(O)cc(c2)O | 21942422 | |
CHEMBL44 | 1784 | 137 | None | -48 | 7 | Human | 4.3 | pEC50 | = | 4.3 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 270 | 1 | 3 | 5 | 2.6 | Oc1ccc(cc1)c1coc2c(c1=O)c(O)cc(c2)O | 21942422 | |
DB01645 | 1784 | 137 | None | -48 | 7 | Human | 4.3 | pEC50 | = | 4.3 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 270 | 1 | 3 | 5 | 2.6 | Oc1ccc(cc1)c1coc2c(c1=O)c(O)cc(c2)O | 21942422 | |
12440 | 1326 | 0 | None | -4 | 2 | Human | 4.4 | pEC50 | = | 4.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 286 | 1 | 4 | 6 | 2.3 | C1=CC=C(C(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O | 24117141 | |
5281610 | 1326 | 0 | None | -4 | 2 | Human | 4.4 | pEC50 | = | 4.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 286 | 1 | 4 | 6 | 2.3 | C1=CC=C(C(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O | 24117141 | |
CHEMBL503168 | 1326 | 0 | None | -4 | 2 | Human | 4.4 | pEC50 | = | 4.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 286 | 1 | 4 | 6 | 2.3 | C1=CC=C(C(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O | 24117141 | |
4285 | 3110 | 122 | None | -2 | 3 | Human | 4.4 | pEC50 | = | 4.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 274 | 4 | 4 | 5 | 2.3 | Oc1ccc(cc1)CCC(=O)c1c(O)cc(cc1O)O | 24117141 | |
4788 | 3110 | 122 | None | -2 | 3 | Human | 4.4 | pEC50 | = | 4.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 274 | 4 | 4 | 5 | 2.3 | Oc1ccc(cc1)CCC(=O)c1c(O)cc(cc1O)O | 24117141 | |
CHEMBL45068 | 3110 | 122 | None | -2 | 3 | Human | 4.4 | pEC50 | = | 4.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 274 | 4 | 4 | 5 | 2.3 | Oc1ccc(cc1)CCC(=O)c1c(O)cc(cc1O)O | 24117141 | |
DB07810 | 3110 | 122 | None | -2 | 3 | Human | 4.4 | pEC50 | = | 4.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 274 | 4 | 4 | 5 | 2.3 | Oc1ccc(cc1)CCC(=O)c1c(O)cc(cc1O)O | 24117141 | |
12463 | 3563 | 0 | None | - | 1 | Human | 4.4 | pEC50 | = | 4.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 286 | 1 | 4 | 6 | 2.3 | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C=C(C(=C3O)O)O)O | 24117141 | |
5281697 | 3563 | 0 | None | - | 1 | Human | 4.4 | pEC50 | = | 4.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 286 | 1 | 4 | 6 | 2.3 | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C=C(C(=C3O)O)O)O | 24117141 | |
CHEMBL55415 | 3563 | 0 | None | - | 1 | Human | 4.4 | pEC50 | = | 4.4 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 286 | 1 | 4 | 6 | 2.3 | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C=C(C(=C3O)O)O)O | 24117141 | |
10298 | 2736 | 0 | None | - | 1 | Human | 4.5 | pEC50 | = | 4.5 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 272 | 1 | 3 | 5 | 2.5 | Oc1ccc(cc1)C1CC(=O)c2c(O1)cc(cc2O)O | 24117141 | |
932 | 2736 | 0 | None | - | 1 | Human | 4.5 | pEC50 | = | 4.5 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 272 | 1 | 3 | 5 | 2.5 | Oc1ccc(cc1)C1CC(=O)c2c(O1)cc(cc2O)O | 24117141 | |
CHEMBL32571 | 2736 | 0 | None | - | 1 | Human | 4.5 | pEC50 | = | 4.5 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 272 | 1 | 3 | 5 | 2.5 | Oc1ccc(cc1)C1CC(=O)c2c(O1)cc(cc2O)O | 24117141 | |
107905 | 1573 | 83 | None | - | 1 | Human | 4.7 | pEC50 | = | 4.7 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 442 | 3 | 7 | 10 | 2.5 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O | 25273142 | |
12462 | 1573 | 83 | None | - | 1 | Human | 4.7 | pEC50 | = | 4.7 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 442 | 3 | 7 | 10 | 2.5 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O | 25273142 | |
CHEMBL36327 | 1573 | 83 | None | - | 1 | Human | 4.7 | pEC50 | = | 4.7 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 442 | 3 | 7 | 10 | 2.5 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O | 25273142 | |
5215 | 2386 | 132 | None | -1 | 4 | Human | 5.1 | pEC50 | = | 5.1 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 286 | 1 | 4 | 6 | 2.3 | Oc1cc(O)c2c(c1)oc(cc2=O)c1ccc(c(c1)O)O | 24117141 | |
5280445 | 2386 | 132 | None | -1 | 4 | Human | 5.1 | pEC50 | = | 5.1 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 286 | 1 | 4 | 6 | 2.3 | Oc1cc(O)c2c(c1)oc(cc2=O)c1ccc(c(c1)O)O | 24117141 | |
CHEMBL151 | 2386 | 132 | None | -1 | 4 | Human | 5.1 | pEC50 | = | 5.1 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 286 | 1 | 4 | 6 | 2.3 | Oc1cc(O)c2c(c1)oc(cc2=O)c1ccc(c(c1)O)O | 24117141 | |
12464 | 3797 | 0 | None | - | 1 | Human | 5.6 | pEC50 | = | 5.6 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 564 | 2 | 9 | 12 | 2.2 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC4=C(C(=C(C=C4[C@@H]5[C@@H](CC6=C(C=C(C=C6O5)O)O)O)O)O)C(=O)C(=C3)O)O | 25273142 | |
135403798 | 3797 | 0 | None | - | 1 | Human | 5.6 | pEC50 | = | 5.6 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 564 | 2 | 9 | 12 | 2.2 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC4=C(C(=C(C=C4[C@@H]5[C@@H](CC6=C(C=C(C=C6O5)O)O)O)O)O)C(=O)C(=C3)O)O | 25273142 | |
12465 | 3798 | 0 | None | - | 1 | Human | 6.2 | pEC50 | = | 6.2 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 716 | 4 | 11 | 16 | 3.2 | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C4=C3C=C(C=C(C4=O)O)[C@@H]5[C@@H](CC6=C(C=C(C=C6O5)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)O | 25273142 |
Showing 1 to 50 of 54 entries
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Similar- ity
| Common name
| GPCRdb ID | #Vendors
| Reference ligand | Fold selectivity | # Tested GPCRs
| Species | p-value (-log)
| Activity Type
| Activity Relation
| Activity Value
| Assay Type
| Assay Description
| Source | Mol weight | Rot Bonds | H don | H acc | LogP
| Smiles
| DOI |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Assay information
| Chemical information
| |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Similar- ity
| Common name
| GPCRdb ID | #Vendors
| Reference ligand | Fold selectivity | # Tested GPCRs
| Species | p-value (-log)
| Activity Type
| Activity Relation
| Activity Value
| Assay Type
| Assay Description
| Source | Mol weight | Rot Bonds | H don | H acc | LogP
| Smiles
| DOI |
No data available in table |
Showing 0 to 0 of 0 entries