spiradoline
SMILES | O=C(N([C@H]1CC[C@]2(C[C@@H]1N1CCCC1)CCCO2)C)Cc1ccc(c(c1)Cl)Cl |
InChIKey | NYKCGQQJNVPOLU-ONTIZHBOSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 0 |
Rotatable bonds | 4 |
Molecular weight (Da) | 424.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
κ | OPRK | Rat | Opioid | A | pKi | 9.0 | 9.0 | 9.0 | Guide to Pharmacology |
κ | OPRK | Mouse | Opioid | A | pKi | 8.95 | 8.95 | 8.95 | ChEMBL |
κ | OPRK | Guinea pig | Opioid | A | pKi | 7.77 | 7.92 | 8.07 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 5.03 | 5.03 | 5.03 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 8.48 | 8.48 | 8.48 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 7.02 | 7.02 | 7.02 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
κ | OPRK | Mouse | Opioid | A | pIC50 | 9.0 | 9.0 | 9.0 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pEC50 | 7.75 | 7.75 | 7.75 | ChEMBL |
κ | OPRK | Human | Opioid | A | pIC50 | 8.08 | 8.08 | 8.08 | ChEMBL |
μ | OPRM | Human | Opioid | A | pIC50 | 6.63 | 6.63 | 6.63 | ChEMBL |