compound 27 [PMID: 20346665]
SMILES | Cc1ccc(cc1)n1cnc2c(c1=O)sc1c2c(N)nc(n1)C |
InChIKey | RIMQNIZNDUNPQK-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 7 |
Hydrogen bond donors | 1 |
Rotatable bonds | 1 |
Molecular weight (Da) | 323.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 8.1 | 8.1 | 8.1 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 6.94 | 6.94 | 6.94 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 7.57 | 7.57 | 7.57 | Guide to Pharmacology |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 7.57 | 7.57 | 7.57 | ChEMBL |