UCM-14216
SMILES | ClC1=C(OC=2C(=NNC2C)C3=C(C=C(C=C3)OCC4=NN=NN4)O)C=CC(=C1)Cl |
InChIKey | RZGVUGDKIXTIMM-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 7 |
Hydrogen bond donors | 3 |
Rotatable bonds | 6 |
Molecular weight (Da) | 432.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
LPA2 | LPAR2 | Human | Lysophospholipid (LPA) | A | pKd | 8.89 | 8.89 | 8.89 | Guide to Pharmacology |
LPA2 | LPAR2 | Human | Lysophospholipid (LPA) | A | pKd | 8.89 | 8.89 | 8.89 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
LPA2 | LPAR2 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.72 | 5.72 | 5.72 | Guide to Pharmacology |
LPA2 | LPAR2 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.72 | 5.72 | 5.72 | ChEMBL |