VU0364770
SMILES | Clc1cccc(c1)NC(=O)c1ccccn1 |
InChIKey | SUYUTNCKIOLMAJ-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 1 |
Rotatable bonds | 2 |
Molecular weight (Da) | 232.0 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Structure pdb | 8JD6 |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pEC50 | 6.0 | 6.0 | 6.0 | Guide to Pharmacology |
mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pEC50 | 6.5 | 6.5 | 6.5 | Guide to Pharmacology |
mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pEC50 | 6.48 | 6.51 | 6.54 | ChEMBL |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pEC50 | 5.92 | 5.95 | 5.96 | ChEMBL |