(-)-cyclazocine
SMILES | Oc1ccc2c(c1)[C@]1(C)CCN([C@@H](C2)C1C)CC1CC1 |
InChIKey | YQYVFVRQLZMJKJ-OTLVQASYSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 1 |
Rotatable bonds | 2 |
Molecular weight (Da) | 271.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 9.1 | 9.1 | 9.1 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 10.0 | 10.0 | 10.0 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 10.0 | 10.0 | 10.0 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |