dihydromorphine
SMILES | O[C@H]1CC[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1O |
InChIKey | IJVCSMSMFSCRME-KBQPJGBKSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 2 |
Rotatable bonds | 0 |
Molecular weight (Da) | 287.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
κ | OPRK | Human | Opioid | A | pKi | 7.1 | 7.1 | 7.1 | Guide to Pharmacology |
κ | OPRK | Rat | Opioid | A | pKd | 6.08 | 6.08 | 6.08 | ChEMBL |
μ | OPRM | Rat | Opioid | A | pKd | 8.0 | 8.85 | 9.7 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 8.77 | 8.77 | 8.77 | PDSP Ki database |
δ | OPRD | Human | Opioid | A | pKi | 6.69 | 6.69 | 6.69 | PDSP Ki database |
κ | OPRK | Human | Opioid | A | pKi | 7.08 | 7.08 | 7.08 | PDSP Ki database |
δ | A0A286XTF2 | Guinea pig | Opioid | A | pKi | 7.33 | 7.37 | 7.4 | PDSP Ki database |
δ | OPRD | Mouse | Opioid | A | pKi | 6.9 | 6.9 | 6.9 | PDSP Ki database |
μ | OPRM | Bovine | Opioid | A | pKi | 7.88 | 8.76 | 9.64 | PDSP Ki database |
δ | F1N083 | Bovine | Opioid | A | pKi | 6.0 | 6.96 | 7.45 | PDSP Ki database |
κ | OPRK | Guinea pig | Opioid | A | pKi | 6.74 | 6.92 | 7.1 | PDSP Ki database |
μ | OPRM | Rat | Opioid | A | pKi | 6.85 | 8.7 | 9.55 | PDSP Ki database |
δ | OPRD | Human | Opioid | A | pKi | 6.7 | 6.7 | 6.7 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 8.8 | 8.8 | 8.8 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |