LY341495
SMILES | OC(=O)[C@H]1C[C@@H]1[C@](C(=O)O)(CC1c2ccccc2Oc2c1cccc2)N |
InChIKey | VLZBRVJVCCNPRJ-KPHUOKFYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 3 |
Rotatable bonds | 5 |
Molecular weight (Da) | 353.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 9.3 | 9.3 | 9.3 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 8.2 | 8.2 | 8.2 | Guide to Pharmacology |
δ | OPRD | Mouse | Opioid | A | pKi | 8.3 | 8.3 | 8.3 | Guide to Pharmacology |
μ | OPRM | Rat | Opioid | A | pKi | 7.51 | 7.51 | 7.51 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 9.26 | 9.26 | 9.26 | PDSP Ki database |
μ | OPRM | Human | Opioid | A | pKi | 7.86 | 7.86 | 7.86 | PDSP Ki database |
δ | A0A286XTF2 | Guinea pig | Opioid | A | pKi | 8.2 | 8.2 | 8.2 | PDSP Ki database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pIC50 | 8.89 | 8.89 | 8.89 | ChEMBL |
δ | OPRD | Mouse | Opioid | A | pIC50 | 9.24 | 9.24 | 9.24 | ChEMBL |
κ | OPRK | Guinea pig | Opioid | A | pIC50 | 6.22 | 6.22 | 6.22 | ChEMBL |