ramatroban
SMILES | OC(=O)CCn1c2CC[C@H](Cc2c2c1cccc2)NS(=O)(=O)c1ccc(cc1)F |
InChIKey | LDXDSHIEDAPSSA-OAHLLOKOSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 2 |
Rotatable bonds | 6 |
Molecular weight (Da) | 416.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Structure pdb | 6IIU |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
MC1 | MSHR | Human | Melanocortin | A | pKd | 7.0 | 7.0 | 7.0 | Guide to Pharmacology |
MC3 | MC3R | Human | Melanocortin | A | pKd | 7.3 | 7.3 | 7.3 | Guide to Pharmacology |
MC4 | MC4R | Human | Melanocortin | A | pKd | 8.5 | 8.5 | 8.5 | Guide to Pharmacology |
MC4 | MC4R | Human | Melanocortin | A | pKi | 8.5 | 8.5 | 8.5 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |