PGI2
SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H](O)C[C@H]2[C@@H]1C/C(=C/CCCC(=O)O)/O2)O |
InChIKey | KAQKFAOMNZTLHT-OZUDYXHBSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 3 |
Rotatable bonds | 10 |
Molecular weight (Da) | 352.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Endogenous |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
κ | OPRK | Human | Opioid | A | pKi | 6.59 | 6.59 | 6.59 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 8.7 | 8.7 | 8.7 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 6.58 | 6.58 | 6.58 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 8.02 | 8.02 | 8.02 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 8.1 | 8.1 | 8.1 | Drug Central |
κ | OPRK | Human | Opioid | A | pKi | 8.18 | 8.18 | 8.18 | Drug Central |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |