IN-3
SMILES | Cc1cc(C)cc(c1)c1[nH]c2c(c1[C@@H](CNCCc1ccncc1)C)cc(cc2)C(C(=O)N1CC2CCC1CC2)(C)C |
InChIKey | GGVFLXSCFPVLMS-WPCLDFDBSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 2 |
Rotatable bonds | 9 |
Molecular weight (Da) | 562.4 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
GnRH1 | GNRHR | Human | Gonadotrophin-releasing hormone | A | pIC50 | 9.22 | 9.22 | 9.22 | Guide to Pharmacology |
GnRH1 | GNRHR | Rat | Gonadotrophin-releasing hormone | A | pIC50 | 8.77 | 8.77 | 8.77 | Guide to Pharmacology |
GnRH1 | GNRHR | Rat | Gonadotrophin-releasing hormone | A | pIC50 | 8.77 | 8.77 | 8.77 | ChEMBL |
GnRH1 | GNRHR | Human | Gonadotrophin-releasing hormone | A | pIC50 | 8.14 | 8.68 | 9.22 | ChEMBL |