L-161,982 (EP4A)
SMILES | CCCCc1nn(c(=O)n1Cc1ccc(cc1)c1ccccc1S(=O)(=O)NC(=O)c1ccc(s1)C)c1ccccc1C(F)(F)F |
InChIKey | JYZLVNVGBRFRME-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 8 |
Hydrogen bond donors | 1 |
Rotatable bonds | 10 |
Molecular weight (Da) | 654.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
EP4 | PE2R4 | Human | Prostanoid | A | pKi | 7.6 | 8.05 | 8.5 | Guide to Pharmacology |
EP4 | PE2R4 | Rat | Prostanoid | A | pKi | 7.5 | 7.5 | 7.5 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
AT1 | AGTR1 | Rabbit | Angiotensin | A | pIC50 | 9.19 | 9.19 | 9.19 | ChEMBL |
AT2 | AGTR2 | Rat | Angiotensin | A | pIC50 | 6.72 | 6.72 | 6.72 | ChEMBL |