CHEMBL1254117
SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)N/N=C2\C(=O)Nc3ccccc32)c2ccc(C)cc2)cc1 |
InChIKey | IMTZHKQCVJWSGI-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 6 |
Hydrogen bond donors | 2 |
Rotatable bonds | 8 |
Molecular weight (Da) | 492.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pKi | 7.6 | 8.38 | 9.17 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 7.85 | 7.85 | 7.85 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 5.6 | 5.6 | 5.6 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 5.85 | 5.85 | 5.85 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Human | Vasopressin and oxytocin | A | pIC50 | 7.52 | 7.52 | 7.52 | ChEMBL |