LY2456302
SMILES | Cc1cc(C)cc(c1)[C@@H]1CCCN1Cc1ccc(cc1)Oc1ccc(cc1F)C(=O)N |
InChIKey | ZHPMYDSXGRRERG-DEOSSOPVSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 1 |
Rotatable bonds | 6 |
Molecular weight (Da) | 418.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
μ | OPRM | Human | Opioid | A | pKi | 7.64 | 7.71 | 7.79 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 7.62 | 7.62 | 7.62 | Guide to Pharmacology |
δ | OPRD | Human | Opioid | A | pKi | 6.78 | 6.85 | 6.91 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 6.81 | 6.81 | 6.81 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 9.02 | 9.11 | 9.22 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 9.09 | 9.09 | 9.09 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
κ | OPRK | Human | Opioid | A | pKB | 9.09 | 9.09 | 9.09 | Guide to Pharmacology |