(+)-MCPG
SMILES | OC(=O)c1ccc(cc1)[C@@](C(=O)O)(N)C |
InChIKey | DNCAZYRLRMTVSF-JTQLQIEISA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 3 |
Rotatable bonds | 3 |
Molecular weight (Da) | 209.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 3.8 | 3.8 | 3.8 | Guide to Pharmacology |
mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pKi | 3.8 | 3.8 | 3.8 | Guide to Pharmacology |
mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pKi | 3.2 | 3.2 | 3.2 | Guide to Pharmacology |
mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pKi | 4.6 | 4.6 | 4.6 | Guide to Pharmacology |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 3.8 | 3.8 | 3.8 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pIC50 | 5.37 | 5.37 | 5.37 | ChEMBL |
TSH | TSHR | Human | Glycoprotein hormone | A | Potency | 5.4 | 5.4 | 5.4 | ChEMBL |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 5.37 | 5.37 | 5.37 | ChEMBL |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pIC50 | 3.7 | 3.7 | 3.7 | Guide to Pharmacology |