MPPG
SMILES | OC(=O)C(c1ccc(cc1)P(=O)(O)O)(N)C |
InChIKey | PAONCRJPUQXPRW-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 4 |
Rotatable bonds | 3 |
Molecular weight (Da) | 245.0 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pKi | 3.8 | 3.8 | 3.8 | Guide to Pharmacology |
mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pKi | 4.2 | 4.2 | 4.2 | Guide to Pharmacology |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 4.96 | 4.96 | 4.96 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu6 | GRM6 | Human | Metabotropic glutamate | C | pIC50 | 3.3 | 3.3 | 3.3 | Guide to Pharmacology |
mGlu8 | GRM8 | Human | Metabotropic glutamate | C | pIC50 | 4.33 | 4.33 | 4.33 | Guide to Pharmacology |