ADPβS
SMILES | O[C@@H]1[C@@H](COP(=O)(OP(=S)(O)O)O)O[C@H]([C@@H]1O)n1cnc2c1ncnc2N |
InChIKey | HCIKUKNAJRJFOW-KQYNXXCUSA-N |
Chemical properties
Hydrogen bond acceptors | 12 |
Hydrogen bond donors | 6 |
Rotatable bonds | 6 |
Molecular weight (Da) | 443.0 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
P2Y11 | P2Y11 | Human | P2Y | A | pEC50 | 3.8 | 4.15 | 4.5 | Guide to Pharmacology |
P2Y12 | P2Y12 | Human | P2Y | A | pIC50 | 8.6 | 8.6 | 8.6 | Guide to Pharmacology |
P2Y13 | P2Y13 | Human | P2Y | A | pIC50 | 5.7 | 5.7 | 5.7 | Guide to Pharmacology |
P2Y12 | P2Y12 | Rat | P2Y | A | pEC50 | 7.09 | 7.09 | 7.09 | ChEMBL |
P2Y1 | P2RY1 | Wild turkey | P2Y | A | pEC50 | 7.02 | 7.02 | 7.02 | ChEMBL |
P2Y1 | P2RY1 | Human | P2Y | A | pEC50 | 5.9 | 5.9 | 5.9 | ChEMBL |
P2Y1 | P2RY1 | Human | P2Y | A | pEC50 | 7.3 | 7.3 | 7.3 | Guide to Pharmacology |
P2Y11 | P2Y11 | Human | P2Y | A | pEC50 | 4.49 | 4.5 | 4.52 | ChEMBL |