OPC-51803
SMILES | CC(NC(=O)C[C@H]1CCCN(c2c1cccc2)C(=O)c1ccc(cc1Cl)N1CCCC1)C |
InChIKey | INGXCNVWWKKWOO-LJQANCHMSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 1 |
Rotatable bonds | 5 |
Molecular weight (Da) | 453.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.1 | 6.1 | 6.1 | Guide to Pharmacology |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 7.0 | 7.0 | 7.0 | Guide to Pharmacology |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 7.04 | 7.04 | 7.04 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.09 | 6.09 | 6.09 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
V2 | V2R | Rat | Vasopressin and oxytocin | A | pIC50 | 6.64 | 6.64 | 6.64 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pIC50 | 6.48 | 6.48 | 6.48 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pEC50 | 6.72 | 6.72 | 6.72 | ChEMBL |