pexacerfont
SMILES | CC[C@H](Nc1nc(C)nc2n1nc(c2c1ccc(nc1C)OC)C)C |
InChIKey | LBWQSAZEYIZZCE-SNVBAGLBSA-N |
Chemical properties
Hydrogen bond acceptors | 7 |
Hydrogen bond donors | 1 |
Rotatable bonds | 5 |
Molecular weight (Da) | 340.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
A1 | AA1R | Rat | Adenosine | A | pKi | 5.58 | 5.58 | 5.58 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
CRF1 | CRFR1 | Rat | Corticotropin-releasing factor | B1 | pIC50 | 6.89 | 6.89 | 6.89 | Guide to Pharmacology |
CRF1 | CRFR1 | Rat | Corticotropin-releasing factor | B1 | pIC50 | 6.89 | 7.77 | 8.21 | ChEMBL |
NK2 | NK2R | Human | Tachykinin | A | pIC50 | 5.31 | 5.31 | 5.31 | ChEMBL |
CRF1 | CRFR1 | Human | Corticotropin-releasing factor | B1 | pIC50 | 6.47 | 7.68 | 8.35 | ChEMBL |
CRF1 | CRFR1 | Human | Corticotropin-releasing factor | B1 | pIC50 | 6.47 | 6.47 | 6.47 | Guide to Pharmacology |