alvimopan
SMILES | OC(=O)CNC(=O)[C@@H](Cc1ccccc1)CN1CC[C@@]([C@H](C1)C)(C)c1cccc(c1)O |
InChIKey | UPNUIXSCZBYVBB-JVFUWBCBSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 3 |
Rotatable bonds | 8 |
Molecular weight (Da) | 424.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Structure pdb | 7UL4 |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 7.92 | 7.92 | 7.92 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 7.0 | 7.0 | 7.0 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 9.33 | 9.33 | 9.33 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 8.15 | 8.15 | 8.15 | Drug Central |
μ | OPRM | Human | Opioid | A | pKi | 8.03 | 8.03 | 8.03 | Drug Central |
δ | OPRD | Human | Opioid | A | pKi | 8.1 | 8.1 | 8.1 | Drug Central |
δ | OPRD | Human | Opioid | A | pKi | 7.92 | 8.11 | 8.3 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 7.0 | 7.0 | 7.0 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 9.11 | 9.31 | 9.5 | ChEMBL |
κ | OPRK | Guinea pig | Opioid | A | pKi | 8.08 | 8.08 | 8.08 | Drug Central |
κ | OPRK | Guinea pig | Opioid | A | pKi | 8.3 | 8.3 | 8.3 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
μ | OPRM | Human | Opioid | A | pIC50 | 8.5 | 8.6 | 8.77 | ChEMBL |