Bremelanotide
Chemical Properties
SMILES | CCCC[C@@H](C(=O)N[C@H]1CC(=O)NCCCC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC1=O)Cc1[nH]cnc1)Cc1ccccc1)CCCN=C(N)N)Cc1c[nH]c2c1cccc2)C(=O)O)NC(=O)C |
Hydrogen bond acceptors | None |
Hydrogen bond donors | None |
Rotatable bonds | None |
Molecular weight |
Drug Properties
Type | Peptide |
Endogenous | No |
Approved | Yes |
InChIKey | FFHBJDQSGDNCIV-MFVUMRCOSA-N |
Bioactivity
Receptor | Experimental Data | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
MC1 | MSHR | Human | Melanocortin | A | pKi | 8.19 | 8.19 | 8.19 | Guide to Pharmacology |
MC3 | MC3R | Human | Melanocortin | A | pKi | 7.28 | 7.28 | 7.28 | Guide to Pharmacology |
MC4 | MC4R | Human | Melanocortin | A | pKi | 9.6 | 9.6 | 9.6 | Guide to Pharmacology |
MC5 | MC5R | Human | Melanocortin | A | pKi | 7.77 | 7.77 | 7.77 | Guide to Pharmacology |
MC1 | MSHR | Human | Melanocortin | A | pKi | 8.19 | 8.46 | 8.72 | ChEMBL |
MC1 | MSHR | Human | Melanocortin | A | pEC50 | 10.02 | 10.02 | 10.02 | ChEMBL |
MC5 | MC5R | Human | Melanocortin | A | pKi | 7.77 | 7.77 | 7.77 | ChEMBL |
MC5 | MC5R | Human | Melanocortin | A | pIC50 | 6.71 | 6.71 | 6.71 | ChEMBL |
MC3 | MC3R | Human | Melanocortin | A | pKi | 6.72 | 7.0 | 7.28 | ChEMBL |
MC3 | MC3R | Human | Melanocortin | A | pEC50 | 8.62 | 8.62 | 8.62 | ChEMBL |
MC4 | MC4R | Human | Melanocortin | A | pKi | 7.61 | 8.61 | 9.6 | ChEMBL |
MC4 | MC4R | Human | Melanocortin | A | pEC50 | 8.39 | 9.23 | 9.7 | ChEMBL |