5BrUTP
SMILES | O[C@@H]1[C@@H](COP(=O)(OP(=O)(OP(=O)(O)O)O)O)O[C@H]([C@@H]1O)n1cc(Br)c(=O)[nH]c1=O |
InChIKey | IWFHOSULCAJGRM-UAKXSSHOSA-N |
Chemical properties
Hydrogen bond acceptors | 12 |
Hydrogen bond donors | 7 |
Rotatable bonds | 8 |
Molecular weight (Da) | 561.9 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
P2Y2 | P2RY2 | Human | P2Y | A | pEC50 | 5.7 | 5.7 | 5.7 | Guide to Pharmacology |
P2Y6 | P2RY6 | Human | P2Y | A | pEC50 | 6.1 | 6.1 | 6.1 | Guide to Pharmacology |
P2Y4 | P2RY4 | Human | P2Y | A | pEC50 | 5.0 | 5.23 | 5.46 | ChEMBL |
P2Y6 | P2RY6 | Human | P2Y | A | pEC50 | 6.1 | 6.32 | 6.54 | ChEMBL |
P2Y2 | P2RY2 | Human | P2Y | A | pEC50 | 5.69 | 6.23 | 6.66 | ChEMBL |