bosentan
SMILES | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 |
InChIKey | GJPICJJJRGTNOD-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 10 |
Hydrogen bond donors | 2 |
Rotatable bonds | 10 |
Molecular weight (Da) | 551.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Structure pdb | 5XPR |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
ETB | EDNRB | Human | Endothelin | A | pKi | 7.1 | 7.1 | 7.1 | Guide to Pharmacology |
ETB | EDNRB | Rat | Endothelin | A | pKd | 5.8 | 5.8 | 5.8 | ChEMBL |
ETA | EDNRA | Rat | Endothelin | A | pKi | 8.19 | 8.19 | 8.19 | ChEMBL |
ETA | EDNRA | Rat | Endothelin | A | pKd | 7.14 | 7.28 | 7.4 | ChEMBL |
ETB | EDNRB | Human | Endothelin | A | pKi | 6.47 | 6.81 | 7.1 | ChEMBL |
ETA | EDNRA | Human | Endothelin | A | pKi | 7.09 | 7.79 | 8.19 | ChEMBL |
ETA | EDNRA | Human | Endothelin | A | pKi | 7.83 | 7.95 | 8.07 | PDSP Ki database |
ETB | EDNRB | Human | Endothelin | A | pKi | 6.87 | 6.93 | 6.99 | PDSP Ki database |
ETA | EDNRA | Human | Endothelin | A | pKi | 8.09 | 8.09 | 8.09 | Drug Central |
ETB | EDNRB | Human | Endothelin | A | pKi | 8.15 | 8.15 | 8.15 | Drug Central |
ETA | EDNRA | Rat | Endothelin | A | pKi | 8.09 | 8.09 | 8.09 | Drug Central |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
ETB | EDNRB | Rat | Endothelin | A | pA2 | 6.0 | 6.0 | 6.0 | Guide to Pharmacology |
ETA | EDNRA | Rat | Endothelin | A | pA2 | 7.2 | 7.2 | 7.2 | Guide to Pharmacology |
ETB | EDNRB | Rat | Endothelin | A | pIC50 | 7.02 | 7.02 | 7.02 | ChEMBL |
ETA | EDNRA | Rat | Endothelin | A | pIC50 | 8.33 | 8.59 | 8.85 | ChEMBL |
ETB | EDNRB | Human | Endothelin | A | pIC50 | 6.0 | 6.65 | 7.02 | ChEMBL |
ETA | EDNRA | Human | Endothelin | A | pIC50 | 5.8 | 7.43 | 8.33 | ChEMBL |
ETB | EDNRB | Rat | Endothelin | A | pIC50 | 8.15 | 8.15 | 8.15 | Drug Central |
ETA | EDNRA | Pig | Endothelin | A | pIC50 | 8.09 | 8.09 | 8.09 | Drug Central |
ETA | EDNRA | Pig | Endothelin | A | pIC50 | 8.12 | 8.12 | 8.12 | ChEMBL |