ADX71743
SMILES | CCc1nc2c(o1)CC(CC2=O)c1ccc(cc1C)C |
InChIKey | CPKZCQHJDFSOJT-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 0 |
Rotatable bonds | 2 |
Molecular weight (Da) | 269.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pIC50 | 7.2 | 7.2 | 7.2 | Guide to Pharmacology |
mGlu7 | GRM7 | Rat | Metabotropic glutamate | C | pIC50 | 7.1 | 7.1 | 7.1 | Guide to Pharmacology |
mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pIC50 | 7.2 | 7.2 | 7.2 | ChEMBL |
mGlu7 | GRM7 | Rat | Metabotropic glutamate | C | pIC50 | 6.17 | 6.18 | 6.19 | ChEMBL |