ADX88178
SMILES | Cc1ccnc(n1)Nc1sc(c(n1)c1c[nH]nc1)C |
InChIKey | MIQNXKWDQRNHAU-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 6 |
Hydrogen bond donors | 2 |
Rotatable bonds | 3 |
Molecular weight (Da) | 272.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Structure pdb | 8JD5 |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pKi | 7.4 | 7.4 | 7.4 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pEC50 | 8.5 | 8.5 | 8.5 | Guide to Pharmacology |
mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pEC50 | 8.04 | 8.04 | 8.04 | Guide to Pharmacology |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pEC50 | 7.28 | 7.65 | 8.4 | ChEMBL |
mGlu8 | GRM8 | Human | Metabotropic glutamate | C | pEC50 | 5.92 | 5.92 | 5.92 | ChEMBL |
mGlu8 | GRM8 | Rat | Metabotropic glutamate | C | pEC50 | 5.92 | 5.92 | 5.92 | ChEMBL |
mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pEC50 | 8.05 | 8.05 | 8.05 | ChEMBL |