AM966
SMILES | OC(=O)Cc1ccc(cc1)c1ccc(cc1)c1onc(c1NC(=O)O[C@@H](c1ccccc1Cl)C)C |
InChIKey | WWQTWEWAPUCDDZ-QGZVFWFLSA-N |
Chemical properties
Hydrogen bond acceptors | 5 |
Hydrogen bond donors | 2 |
Rotatable bonds | 7 |
Molecular weight (Da) | 490.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pIC50 | 6.7 | 7.25 | 7.8 | Guide to Pharmacology |
LPA2 | LPAR2 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.8 | 5.8 | 5.8 | Guide to Pharmacology |
LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.7 | 5.7 | 5.7 | Guide to Pharmacology |
LPA4 | LPAR4 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.1 | 5.1 | 5.1 | Guide to Pharmacology |
LPA1 | LPAR1 | Mouse | Lysophospholipid (LPA) | A | pEC50 | 7.7 | 7.7 | 7.7 | Guide to Pharmacology |
LPA2 | LPAR2 | Mouse | Lysophospholipid (LPA) | A | pIC50 | 4.6 | 4.6 | 4.6 | Guide to Pharmacology |
LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pIC50 | 7.77 | 7.77 | 7.77 | ChEMBL |
LPA2 | LPAR2 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.77 | 5.77 | 5.77 | ChEMBL |
LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.8 | 5.8 | 5.8 | ChEMBL |
LPA3 | LPAR3 | Mouse | Lysophospholipid (LPA) | A | pIC50 | 6.8 | 6.8 | 6.8 | Guide to Pharmacology |