butorphanol
SMILES | Oc1ccc2c(c1)[C@]13CCCC[C@]3([C@@H](C2)N(CC1)CC1CCC1)O |
InChIKey | IFKLAQQSCNILHL-QHAWAJNXSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 2 |
Rotatable bonds | 2 |
Molecular weight (Da) | 327.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
μ | OPRM | Human | Opioid | A | pKi | 9.92 | 9.92 | 9.92 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 9.66 | 9.83 | 9.92 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 8.1 | 8.1 | 8.1 | Drug Central |
κ | OPRK | Human | Opioid | A | pKi | 8.0 | 8.0 | 8.0 | Drug Central |
μ | OPRM | Human | Opioid | A | pKi | 8.0 | 8.0 | 8.0 | Drug Central |
δ | OPRD | Human | Opioid | A | pKi | 7.92 | 7.92 | 7.92 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 9.92 | 9.92 | 9.92 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 9.66 | 9.75 | 9.92 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
κ | OPRK | Human | Opioid | A | pEC50 | 8.54 | 8.54 | 8.54 | ChEMBL |
μ | OPRM | Human | Opioid | A | pIC50 | 7.85 | 7.85 | 7.85 | ChEMBL |