BAYu9773
SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)Sc1ccc(cc1)C(=O)O |
InChIKey | PKJINWOACFYDQN-RBVMPENBSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 3 |
Rotatable bonds | 17 |
Molecular weight (Da) | 472.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
CysLT1 | CLTR1 | Guinea pig | Leukotriene | A | pKi | 7.0 | 7.0 | 7.0 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
CysLT1 | CLTR1 | Human | Leukotriene | A | pIC50 | 5.83 | 5.83 | 5.83 | Guide to Pharmacology |
CysLT2 | CLTR2 | Human | Leukotriene | A | pEC50 | 7.1 | 7.1 | 7.1 | Guide to Pharmacology |
CysLT2 | CLTR2 | Human | Leukotriene | A | pIC50 | 6.22 | 6.47 | 7.74 | Guide to Pharmacology |
CysLT2 | CLTR2 | Human | Leukotriene | A | pKB | 6.5 | 6.6 | 6.7 | Guide to Pharmacology |
CysLT2 | CLTR2 | Rat | Leukotriene | A | pA2 | 6.8 | 7.25 | 7.7 | Guide to Pharmacology |
CysLT2 | CLTR2 | Human | Leukotriene | A | pIC50 | 6.52 | 6.52 | 6.52 | ChEMBL |
CysLT1 | CLTR1 | Human | Leukotriene | A | pIC50 | 6.36 | 6.36 | 6.36 | ChEMBL |