compound 11 [PMID: 12812482]
SMILES | O=C(C[C@@H]1C(=O)Nc2c(N1S(=O)(=O)c1ccc(c(c1)Cl)Cl)cccc2)NCCc1ccc(cc1)C1=NCCN1 |
InChIKey | HYJYRDCPGUEYND-XMMPIXPASA-N |
Chemical properties
Hydrogen bond acceptors | 6 |
Hydrogen bond donors | 3 |
Rotatable bonds | 8 |
Molecular weight (Da) | 585.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
B1 | BKRB1 | Human | Bradykinin | A | pKi | 10.5 | 10.5 | 10.5 | Guide to Pharmacology |
B1 | BKRB1 | Rat | Bradykinin | A | pKi | 7.2 | 7.2 | 7.2 | Guide to Pharmacology |
B1 | BKRB1 | Human | Bradykinin | A | pKi | 9.05 | 10.27 | 10.52 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
B1 | BKRB1 | Rabbit | Bradykinin | A | pIC50 | 9.59 | 9.59 | 9.59 | ChEMBL |
B1 | BKRB1 | Rat | Bradykinin | A | pIC50 | 6.79 | 6.79 | 6.79 | ChEMBL |
B1 | BKRB1 | Human | Bradykinin | A | pIC50 | 9.74 | 9.74 | 9.74 | ChEMBL |
B1 | BKRB1 | Dog | Bradykinin | A | pIC50 | 7.79 | 7.79 | 7.79 | ChEMBL |