carfentanil
SMILES | CCC(=O)N(C1(CCN(CC1)CCc1ccccc1)C(=O)OC)c1ccccc1 |
InChIKey | YDSDEBIZUNNPOB-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 0 |
Rotatable bonds | 7 |
Molecular weight (Da) | 394.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
κ | OPRK | Guinea pig | Opioid | A | pKi | 7.37 | 7.37 | 7.37 | Guide to Pharmacology |
δ | A0A286XTF2 | Guinea pig | Opioid | A | pKi | 8.48 | 8.48 | 8.48 | Guide to Pharmacology |
δ | OPRD | Human | Opioid | A | pKi | 8.48 | 8.48 | 8.48 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 7.37 | 7.37 | 7.37 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 10.15 | 10.38 | 10.62 | ChEMBL |
μ | OPRM | Rat | Opioid | A | pKi | 10.05 | 10.34 | 10.62 | ChEMBL |
κ | OPRK | Guinea pig | Opioid | A | pKi | 7.04 | 7.21 | 7.37 | ChEMBL |
μ | OPRM | Mouse | Opioid | A | pKi | 10.62 | 10.62 | 10.62 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Mouse | Opioid | A | pIC50 | 7.77 | 7.77 | 7.77 | ChEMBL |