CPCCOEt
SMILES | CCOC(=O)C12CC2/C(=N\O)/c2c(O1)cccc2 |
InChIKey | FXCTZFMSAHZQTR-KAMYIIQDSA-N |
Chemical properties
Hydrogen bond acceptors | 5 |
Hydrogen bond donors | 1 |
Rotatable bonds | 2 |
Molecular weight (Da) | 247.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 5.3 | 5.3 | 5.3 | Guide to Pharmacology |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pKi | 5.0 | 5.0 | 5.0 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 5.2 | 5.5 | 5.8 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKB | 4.9 | 4.9 | 4.9 | Guide to Pharmacology |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pEC50 | 5.3 | 5.3 | 5.3 | Guide to Pharmacology |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 4.64 | 5.1 | 5.47 | ChEMBL |