eprosartan
| SMILES | CCCCc1ncc(n1Cc1ccc(cc1)C(=O)O)/C=C(/C(=O)O)\Cc1cccs1 |
| InChIKey | OROAFUQRIXKEMV-LDADJPATSA-N |
Chemical properties
| Hydrogen bond acceptors | 5 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 10 |
| Molecular weight (Da) | 424.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | Yes |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| AT1 | AGTRB | Rat | Angiotensin | A | pKd | 9.1 | 9.1 | 9.1 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| AT1 | AGTR1 | Human | Angiotensin | A | pIC50 | 8.4 | 8.6 | 8.8 | Guide to Pharmacology |
| AT1 | AGTR1 | Human | Angiotensin | A | pIC50 | 8.14 | 8.42 | 8.7 | ChEMBL |
| AT1 | AGTR1 | Human | Angiotensin | A | pIC50 | 8.06 | 8.06 | 8.06 | Drug Central |
| AT2 | AGTR2 | Rat | Angiotensin | A | pIC50 | 8.05 | 8.05 | 8.05 | Drug Central |
| AT1 | AGTRB | Rat | Angiotensin | A | pIC50 | 8.05 | 8.05 | 8.05 | Drug Central |
| AT2 | AGTR2 | Rat | Angiotensin | A | pIC50 | 9.0 | 9.0 | 9.0 | ChEMBL |
| AT1 | AGTRB | Rat | Angiotensin | A | pIC50 | 9.0 | 9.0 | 9.0 | ChEMBL |