MNI-136
SMILES | O=C1CCC(=Nc2c(N1)ccc(c2)Br)c1cccc(c1)c1ccncc1 |
InChIKey | BLAQAVITPVXJJS-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 1 |
Rotatable bonds | 2 |
Molecular weight (Da) | 405.0 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pIC50 | 7.33 | 7.7 | 8.06 | Guide to Pharmacology |
mGlu3 | GRM3 | Rat | Metabotropic glutamate | C | pIC50 | 7.7 | 7.7 | 7.7 | Guide to Pharmacology |
mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pIC50 | 7.67 | 7.69 | 7.71 | Guide to Pharmacology |