NF-56-EJ40
SMILES | CN1CCN(CC1)Cc1ccc(cc1)c1cccc(c1)C(=O)Nc1ccccc1CC(=O)O |
InChIKey | UTWXDNZWMQAUKL-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 2 |
Rotatable bonds | 7 |
Molecular weight (Da) | 443.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Structure pdb | 6RNK |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
succinate | SUCR1 | Human | Succinate | A | pKi | 7.76 | 7.76 | 7.76 | Guide to Pharmacology |
succinate | SUCR1 | Human | Succinate | A | pKd | 7.48 | 7.48 | 7.48 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
succinate | SUCR1 | Human | Succinate | A | pIC50 | 7.6 | 7.6 | 7.6 | ChEMBL |