PD 176252
SMILES | COc1ccc(nc1)C1(CCCCC1)CNC(=O)[C@](Cc1c[nH]c2c1cccc2)(NC(=O)Nc1ccc(cc1)[N+](=O)[O-])C |
InChIKey | NNFUWNLENRUDHR-HKBQPEDESA-N |
Chemical properties
Hydrogen bond acceptors | 6 |
Hydrogen bond donors | 4 |
Rotatable bonds | 10 |
Molecular weight (Da) | 584.3 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Structure pdb | 7W41 |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
BB2 | GRPR | Human | Bombesin | A | pKi | 9.0 | 9.0 | 9.0 | Guide to Pharmacology |
BB1 | NMBR | Human | Bombesin | A | pKi | 9.77 | 9.77 | 9.77 | ChEMBL |
BB2 | GRPR | Human | Bombesin | A | pKi | 9.0 | 9.0 | 9.0 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
BB1 | NMBR | Human | Bombesin | A | pIC50 | 9.28 | 9.53 | 9.77 | Guide to Pharmacology |
BB2 | GRPR | Human | Bombesin | A | pIC50 | 6.67 | 6.72 | 6.77 | Guide to Pharmacology |
BB1 | NMBR | Human | Bombesin | A | pIC50 | 9.18 | 9.18 | 9.18 | ChEMBL |
BB2 | GRPR | Human | Bombesin | A | pIC50 | 7.8 | 7.8 | 7.8 | ChEMBL |