PF-05190457
SMILES | Cc1ncnc(c1)c1ccc2c(c1)CC[C@H]2N1CC2(C1)CCN(CC2)C(=O)Cc1nc2n(c1)cc(s2)C |
InChIKey | ZIUDADZJCKGWKR-AREMUKBSSA-N |
Chemical properties
Hydrogen bond acceptors | 7 |
Hydrogen bond donors | 0 |
Rotatable bonds | 4 |
Molecular weight (Da) | 512.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Structure pdb | 7F83 |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
ghrelin | GHSR | Human | Ghrelin | A | pKi | 8.85 | 8.85 | 8.85 | Guide to Pharmacology |
ghrelin | GHSR | Mouse | Ghrelin | A | pKi | 8.11 | 8.11 | 8.11 | Guide to Pharmacology |
ghrelin | GHSR | Rat | Ghrelin | A | pKi | 8.49 | 8.49 | 8.49 | Guide to Pharmacology |
ghrelin | GHSR | Human | Ghrelin | A | pKi | 8.18 | 8.18 | 8.18 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pIC50 | 5.43 | 5.43 | 5.43 | ChEMBL |