probenecid
SMILES | CCCN(S(=O)(=O)c1ccc(cc1)C(=O)O)CCC |
InChIKey | DBABZHXKTCFAPX-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 1 |
Rotatable bonds | 7 |
Molecular weight (Da) | 285.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
TAS2R16 | T2R16 | Human | Taste 2 | T2 | pIC50 | 3.53 | 3.53 | 3.53 | Guide to Pharmacology |
TAS2R38 | T2R38 | Human | Taste 2 | T2 | pIC50 | 3.68 | 3.68 | 3.68 | Guide to Pharmacology |