Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 11120893 | 4524 | None | 0 | Human | Functional | pEC50 | = | 8.0 | 8.0 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 324 | 3 | 2 | 4 | 3.2 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccoc4)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL102250 | 4524 | None | 0 | Human | Functional | pEC50 | = | 8.0 | 8.0 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 324 | 3 | 2 | 4 | 3.2 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccoc4)nc23)CC1 | 10.1021/jm030020m | ||
| 10925382 | 5018 | None | 0 | Human | Functional | pEC50 | = | 8.0 | 8.0 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 324 | 3 | 2 | 4 | 3.2 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccco4)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL105091 | 5018 | None | 0 | Human | Functional | pEC50 | = | 8.0 | 8.0 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 324 | 3 | 2 | 4 | 3.2 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccco4)nc23)CC1 | 10.1021/jm030020m | ||
| 11759467 | 5171 | None | 0 | Human | Functional | pEC50 | = | 8.0 | 8.0 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 335 | 3 | 2 | 4 | 3.0 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccncc4)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL105958 | 5171 | None | 0 | Human | Functional | pEC50 | = | 8.0 | 8.0 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 335 | 3 | 2 | 4 | 3.0 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccncc4)nc23)CC1 | 10.1021/jm030020m | ||
| 10308815 | 123545 | None | 0 | Human | Functional | pEC50 | = | 7.0 | 7.0 | - | 1 | Agonist activity at human 5HT1F receptor expressed in LM(tk-) cells by [35S]GTPgammaS binding assayAgonist activity at human 5HT1F receptor expressed in LM(tk-) cells by [35S]GTPgammaS binding assay |
ChEMBL | 341 | 4 | 1 | 4 | 3.0 | CN1CCC(C(=O)c2cccc(NC(=O)c3ccc(F)cc3)n2)CC1 | 10.1016/j.bmcl.2015.07.042 | ||
| CHEMBL3617557 | 123545 | None | 0 | Human | Functional | pEC50 | = | 7.0 | 7.0 | - | 1 | Agonist activity at human 5HT1F receptor expressed in LM(tk-) cells by [35S]GTPgammaS binding assayAgonist activity at human 5HT1F receptor expressed in LM(tk-) cells by [35S]GTPgammaS binding assay |
ChEMBL | 341 | 4 | 1 | 4 | 3.0 | CN1CCC(C(=O)c2cccc(NC(=O)c3ccc(F)cc3)n2)CC1 | 10.1016/j.bmcl.2015.07.042 | ||
| 11044798 | 5170 | None | 0 | Human | Functional | pEC50 | = | 7.9 | 7.9 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 300 | 4 | 2 | 3 | 3.1 | CCCC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 | 10.1021/jm030020m | ||
| CHEMBL105955 | 5170 | None | 0 | Human | Functional | pEC50 | = | 7.9 | 7.9 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 300 | 4 | 2 | 3 | 3.1 | CCCC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 | 10.1021/jm030020m | ||
| 11372635 | 67108 | None | 0 | Human | Functional | pEC50 | = | 6.9 | 6.9 | - | 1 | Stimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cellsStimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cells |
ChEMBL | 387 | 3 | 1 | 4 | 4.7 | CN1CCC(c2noc3ccc(NC(=O)c4ccc(F)cc4Cl)cc23)CC1 | 10.1016/j.bmcl.2004.09.079 | ||
| CHEMBL187308 | 67108 | None | 0 | Human | Functional | pEC50 | = | 6.9 | 6.9 | - | 1 | Stimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cellsStimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cells |
ChEMBL | 387 | 3 | 1 | 4 | 4.7 | CN1CCC(c2noc3ccc(NC(=O)c4ccc(F)cc4Cl)cc23)CC1 | 10.1016/j.bmcl.2004.09.079 | ||
| 11056946 | 108949 | None | 0 | Human | Functional | pEC50 | = | 7.8 | 7.8 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 340 | 3 | 2 | 4 | 3.7 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4cccs4)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL321080 | 108949 | None | 0 | Human | Functional | pEC50 | = | 7.8 | 7.8 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 340 | 3 | 2 | 4 | 3.7 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4cccs4)nc23)CC1 | 10.1021/jm030020m | ||
| 10946905 | 163777 | None | 0 | Human | Functional | pEC50 | = | 7.7 | 7.7 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 312 | 3 | 2 | 3 | 3.1 | CN1CCC(c2c[nH]c3ccc(NC(=O)C4CCC4)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL420475 | 163777 | None | 0 | Human | Functional | pEC50 | = | 7.7 | 7.7 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 312 | 3 | 2 | 3 | 3.1 | CN1CCC(c2c[nH]c3ccc(NC(=O)C4CCC4)nc23)CC1 | 10.1021/jm030020m | ||
| 11110452 | 5132 | None | 0 | Human | Functional | pEC50 | = | 7.6 | 7.6 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 335 | 3 | 2 | 4 | 3.0 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccccn4)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL105722 | 5132 | None | 0 | Human | Functional | pEC50 | = | 7.6 | 7.6 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 335 | 3 | 2 | 4 | 3.0 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccccn4)nc23)CC1 | 10.1021/jm030020m | ||
| 44387174 | 61793 | None | 0 | Human | Functional | pEC50 | = | 6.6 | 6.6 | - | 1 | Concentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptorConcentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 387 | 3 | 1 | 4 | 4.7 | CN1CCC(c2coc3ccc(NC(=O)c4ccc(F)cc4Cl)nc23)CC1 | 10.1016/j.bmcl.2003.09.091 | ||
| CHEMBL177238 | 61793 | None | 0 | Human | Functional | pEC50 | = | 6.6 | 6.6 | - | 1 | Concentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptorConcentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 387 | 3 | 1 | 4 | 4.7 | CN1CCC(c2coc3ccc(NC(=O)c4ccc(F)cc4Cl)nc23)CC1 | 10.1016/j.bmcl.2003.09.091 | ||
| 9947817 | 5049 | None | 0 | Human | Functional | pEC50 | = | 7.5 | 7.5 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 286 | 3 | 2 | 3 | 2.7 | CCC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 | 10.1021/jm030020m | ||
| CHEMBL105261 | 5049 | None | 0 | Human | Functional | pEC50 | = | 7.5 | 7.5 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 286 | 3 | 2 | 3 | 2.7 | CCC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 | 10.1021/jm030020m | ||
| 11011968 | 4943 | None | 0 | Human | Functional | pEC50 | = | 7.5 | 7.5 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 298 | 3 | 2 | 3 | 2.7 | CN1CCC(c2c[nH]c3ccc(NC(=O)C4CC4)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL104720 | 4943 | None | 0 | Human | Functional | pEC50 | = | 7.5 | 7.5 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 298 | 3 | 2 | 3 | 2.7 | CN1CCC(c2c[nH]c3ccc(NC(=O)C4CC4)nc23)CC1 | 10.1021/jm030020m | ||
| 2543 | 3707 | None | 46 | Human | Functional | pEC50 | = | 7.5 | 7.5 | -3 | 14 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 295 | 6 | 2 | 3 | 1.3 | CNS(=O)(=O)Cc1ccc2c(c1)c(CCN(C)C)c[nH]2 | 10.1021/jm0155190 | ||
| 5358 | 3707 | None | 46 | Human | Functional | pEC50 | = | 7.5 | 7.5 | -3 | 14 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 295 | 6 | 2 | 3 | 1.3 | CNS(=O)(=O)Cc1ccc2c(c1)c(CCN(C)C)c[nH]2 | 10.1021/jm0155190 | ||
| 5358.0 | 3707 | None | 46 | Human | Functional | pEC50 | = | 7.5 | 7.5 | -3 | 14 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 295 | 6 | 2 | 3 | 1.3 | CNS(=O)(=O)Cc1ccc2c(c1)c(CCN(C)C)c[nH]2 | 10.1021/jm0155190 | ||
| 54 | 3707 | None | 46 | Human | Functional | pEC50 | = | 7.5 | 7.5 | -3 | 14 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 295 | 6 | 2 | 3 | 1.3 | CNS(=O)(=O)Cc1ccc2c(c1)c(CCN(C)C)c[nH]2 | 10.1021/jm0155190 | ||
| CHEMBL128 | 3707 | None | 46 | Human | Functional | pEC50 | = | 7.5 | 7.5 | -3 | 14 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 295 | 6 | 2 | 3 | 1.3 | CNS(=O)(=O)Cc1ccc2c(c1)c(CCN(C)C)c[nH]2 | 10.1021/jm0155190 | ||
| DB00669 | 3707 | None | 46 | Human | Functional | pEC50 | = | 7.5 | 7.5 | -3 | 14 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 295 | 6 | 2 | 3 | 1.3 | CNS(=O)(=O)Cc1ccc2c(c1)c(CCN(C)C)c[nH]2 | 10.1021/jm0155190 | ||
| 10445946 | 167966 | None | 3 | Human | Functional | pEC50 | = | 7.4 | 7.4 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-HT1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-HT1F receptor |
ChEMBL | 272 | 2 | 2 | 3 | 2.3 | CC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 | 10.1021/jm030020m | ||
| CHEMBL431041 | 167966 | None | 3 | Human | Functional | pEC50 | = | 7.4 | 7.4 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-HT1F receptorIn vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-HT1F receptor |
ChEMBL | 272 | 2 | 2 | 3 | 2.3 | CC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 | 10.1021/jm030020m | ||
| 44395894 | 66969 | None | 0 | Human | Functional | pEC50 | = | 6.3 | 6.3 | - | 1 | Stimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cellsStimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cells |
ChEMBL | 371 | 3 | 1 | 4 | 4.2 | CN1CCC(c2noc3ccc(NC(=O)c4ccc(F)cc4F)cc23)CC1 | 10.1016/j.bmcl.2004.09.079 | ||
| CHEMBL186662 | 66969 | None | 0 | Human | Functional | pEC50 | = | 6.3 | 6.3 | - | 1 | Stimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cellsStimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cells |
ChEMBL | 371 | 3 | 1 | 4 | 4.2 | CN1CCC(c2noc3ccc(NC(=O)c4ccc(F)cc4F)cc23)CC1 | 10.1016/j.bmcl.2004.09.079 | ||
| 44395925 | 67168 | None | 0 | Human | Functional | pEC50 | = | 7.3 | 7.3 | - | 1 | Stimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cellsStimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cells |
ChEMBL | 390 | 3 | 2 | 4 | 3.6 | CN1CCC(N2CNc3ccc(NC(=O)c4c(F)cc(F)cc4F)cc32)CC1 | 10.1016/j.bmcl.2004.09.079 | ||
| CHEMBL187581 | 67168 | None | 0 | Human | Functional | pEC50 | = | 7.3 | 7.3 | - | 1 | Stimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cellsStimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cells |
ChEMBL | 390 | 3 | 2 | 4 | 3.6 | CN1CCC(N2CNc3ccc(NC(=O)c4c(F)cc(F)cc4F)cc32)CC1 | 10.1016/j.bmcl.2004.09.079 | ||
| 122190350 | 123538 | None | 0 | Human | Functional | pEC50 | = | 7.3 | 7.3 | - | 1 | Agonist activity at human 5HT1F receptor expressed in LM(tk-) cells by [35S]GTPgammaS binding assayAgonist activity at human 5HT1F receptor expressed in LM(tk-) cells by [35S]GTPgammaS binding assay |
ChEMBL | 358 | 4 | 1 | 3 | 3.7 | CN1CCC(C(=O)c2cccc(NC(=O)c3ccc(F)cc3)c2F)CC1 | 10.1016/j.bmcl.2015.07.042 | ||
| CHEMBL3617550 | 123538 | None | 0 | Human | Functional | pEC50 | = | 7.3 | 7.3 | - | 1 | Agonist activity at human 5HT1F receptor expressed in LM(tk-) cells by [35S]GTPgammaS binding assayAgonist activity at human 5HT1F receptor expressed in LM(tk-) cells by [35S]GTPgammaS binding assay |
ChEMBL | 358 | 4 | 1 | 3 | 3.7 | CN1CCC(C(=O)c2cccc(NC(=O)c3ccc(F)cc3)c2F)CC1 | 10.1016/j.bmcl.2015.07.042 | ||
| 44352308 | 117551 | None | 0 | Human | Functional | pEC50 | = | 8.2 | 8.2 | - | 1 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 339 | 5 | 2 | 2 | 4.0 | Cc1[nH]c2cccc(NC(=O)c3ccc(F)cc3)c2c1CCN(C)C | 10.1021/jm0155190 | ||
| CHEMBL339980 | 117551 | None | 0 | Human | Functional | pEC50 | = | 8.2 | 8.2 | - | 1 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 339 | 5 | 2 | 2 | 4.0 | Cc1[nH]c2cccc(NC(=O)c3ccc(F)cc3)c2c1CCN(C)C | 10.1021/jm0155190 | ||
| 44395930 | 67030 | None | 0 | Human | Functional | pEC50 | = | 7.2 | 7.2 | - | 1 | Stimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cellsStimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cells |
ChEMBL | 388 | 3 | 2 | 4 | 4.0 | CN1CCC(N2CNc3ccc(NC(=O)c4ccc(F)cc4Cl)cc32)CC1 | 10.1016/j.bmcl.2004.09.079 | ||
| CHEMBL186951 | 67030 | None | 0 | Human | Functional | pEC50 | = | 7.2 | 7.2 | - | 1 | Stimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cellsStimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cells |
ChEMBL | 388 | 3 | 2 | 4 | 4.0 | CN1CCC(N2CNc3ccc(NC(=O)c4ccc(F)cc4Cl)cc32)CC1 | 10.1016/j.bmcl.2004.09.079 | ||
| 9863365 | 61795 | None | 0 | Human | Functional | pEC50 | = | 7.2 | 7.2 | - | 1 | Concentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptorConcentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 353 | 3 | 1 | 4 | 4.0 | CN1CCC(c2coc3ccc(NC(=O)c4ccc(F)cc4)nc23)CC1 | 10.1016/j.bmcl.2003.09.091 | ||
| CHEMBL177258 | 61795 | None | 0 | Human | Functional | pEC50 | = | 7.2 | 7.2 | - | 1 | Concentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptorConcentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 353 | 3 | 1 | 4 | 4.0 | CN1CCC(c2coc3ccc(NC(=O)c4ccc(F)cc4)nc23)CC1 | 10.1016/j.bmcl.2003.09.091 | ||
| 44386896 | 132353 | None | 0 | Human | Functional | pEC50 | = | 7.2 | 7.2 | - | 1 | Concentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptorConcentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 387 | 3 | 1 | 4 | 4.7 | CN1CCC(c2coc3ccc(NC(=O)c4c(F)cccc4Cl)nc23)CC1 | 10.1016/j.bmcl.2003.09.091 | ||
| CHEMBL369705 | 132353 | None | 0 | Human | Functional | pEC50 | = | 7.2 | 7.2 | - | 1 | Concentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptorConcentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptor |
ChEMBL | 387 | 3 | 1 | 4 | 4.7 | CN1CCC(c2coc3ccc(NC(=O)c4c(F)cccc4Cl)nc23)CC1 | 10.1016/j.bmcl.2003.09.091 | ||
| 5 | 139 | None | 45 | Human | Functional | pEC50 | = | 8.1 | 8.1 | -15 | 26 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 176 | 2 | 3 | 2 | 1.4 | NCCc1c[nH]c2c1cc(O)cc2 | 10.1021/jm0155190 | ||
| 5202 | 139 | None | 45 | Human | Functional | pEC50 | = | 8.1 | 8.1 | -15 | 26 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 176 | 2 | 3 | 2 | 1.4 | NCCc1c[nH]c2c1cc(O)cc2 | 10.1021/jm0155190 | ||
| CHEMBL39 | 139 | None | 45 | Human | Functional | pEC50 | = | 8.1 | 8.1 | -15 | 26 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 176 | 2 | 3 | 2 | 1.4 | NCCc1c[nH]c2c1cc(O)cc2 | 10.1021/jm0155190 | ||
| DB08839 | 139 | None | 45 | Human | Functional | pEC50 | = | 8.1 | 8.1 | -15 | 26 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 176 | 2 | 3 | 2 | 1.4 | NCCc1c[nH]c2c1cc(O)cc2 | 10.1021/jm0155190 | ||
Showing 1 to 50 of 135 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 146420029 | 184868 | None | 0 | Human | Binding | pIC50 | = | 9.5 | 9.5 | - | 0 | Binding affinity to human 5HT1F receptorBinding affinity to human 5HT1F receptor |
ChEMBL | 379 | 3 | 1 | 3 | 4.2 | CN1CCC(=C(F)c2cccc(NC(=O)c3c(F)cc(F)cc3F)n2)CC1 | 10.1016/j.ejmech.2021.113782 | ||
| CHEMBL4851044 | 184868 | None | 0 | Human | Binding | pIC50 | = | 9.5 | 9.5 | - | 0 | Binding affinity to human 5HT1F receptorBinding affinity to human 5HT1F receptor |
ChEMBL | 379 | 3 | 1 | 3 | 4.2 | CN1CCC(=C(F)c2cccc(NC(=O)c3c(F)cc(F)cc3F)n2)CC1 | 10.1016/j.ejmech.2021.113782 | ||
| 18366015 | 78403 | None | 0 | Human | Binding | pIC50 | = | 6.4 | 6.4 | - | 0 | Binding affinity towards human recombinant 5-hydroxytryptamine 1F receptorBinding affinity towards human recombinant 5-hydroxytryptamine 1F receptor |
ChEMBL | 313 | 4 | 2 | 3 | 2.6 | CN(C)[C@H]1C[C@H](c2c[nH]c3ccc(CC4COC(=O)N4)cc32)C1 | 10.1021/jm000956k | ||
| CHEMBL2110300 | 78403 | None | 0 | Human | Binding | pIC50 | = | 6.4 | 6.4 | - | 0 | Binding affinity towards human recombinant 5-hydroxytryptamine 1F receptorBinding affinity towards human recombinant 5-hydroxytryptamine 1F receptor |
ChEMBL | 313 | 4 | 2 | 3 | 2.6 | CN(C)[C@H]1C[C@H](c2c[nH]c3ccc(CC4COC(=O)N4)cc32)C1 | 10.1021/jm000956k | ||
| 114 | 2254 | None | 15 | Human | Binding | pIC50 | = | 5.4 | 5.4 | - | 1 | Compound was evaluated for the affinity at 5-hydroxytryptamine 1F receptorCompound was evaluated for the affinity at 5-hydroxytryptamine 1F receptor |
ChEMBL | 432 | 8 | 1 | 5 | 3.7 | Fc1cccc(c1)CCN1CCN(CC1)CCCc1c[nH]c2c1cc(cc2)n1cnnc1 | 10.1021/jm9704560 | ||
| 6426760 | 2254 | None | 15 | Human | Binding | pIC50 | = | 5.4 | 5.4 | - | 1 | Compound was evaluated for the affinity at 5-hydroxytryptamine 1F receptorCompound was evaluated for the affinity at 5-hydroxytryptamine 1F receptor |
ChEMBL | 432 | 8 | 1 | 5 | 3.7 | Fc1cccc(c1)CCN1CCN(CC1)CCCc1c[nH]c2c1cc(cc2)n1cnnc1 | 10.1021/jm9704560 | ||
| CHEMBL292779 | 2254 | None | 15 | Human | Binding | pIC50 | = | 5.4 | 5.4 | - | 1 | Compound was evaluated for the affinity at 5-hydroxytryptamine 1F receptorCompound was evaluated for the affinity at 5-hydroxytryptamine 1F receptor |
ChEMBL | 432 | 8 | 1 | 5 | 3.7 | Fc1cccc(c1)CCN1CCN(CC1)CCCc1c[nH]c2c1cc(cc2)n1cnnc1 | 10.1021/jm9704560 | ||
| 151 | 2416 | None | 39 | Human | Binding | pKi | = | 8.8 | 8.8 | 14 | 4 | Binding affinity at human 5HT1F receptorBinding affinity at human 5HT1F receptor |
ChEMBL | 351 | 3 | 2 | 2 | 4.4 | CN1CCC(CC1)c1c[nH]c2c1cc(cc2)NC(=O)c1ccc(cc1)F | 10.1021/jm7011722 | ||
| 20 | 2416 | None | 39 | Human | Binding | pKi | = | 8.8 | 8.8 | 14 | 4 | Binding affinity at human 5HT1F receptorBinding affinity at human 5HT1F receptor |
ChEMBL | 351 | 3 | 2 | 2 | 4.4 | CN1CCC(CC1)c1c[nH]c2c1cc(cc2)NC(=O)c1ccc(cc1)F | 10.1021/jm7011722 | ||
| 5311258 | 2416 | None | 39 | Human | Binding | pKi | = | 8.8 | 8.8 | 14 | 4 | Binding affinity at human 5HT1F receptorBinding affinity at human 5HT1F receptor |
ChEMBL | 351 | 3 | 2 | 2 | 4.4 | CN1CCC(CC1)c1c[nH]c2c1cc(cc2)NC(=O)c1ccc(cc1)F | 10.1021/jm7011722 | ||
| CHEMBL101690 | 2416 | None | 39 | Human | Binding | pKi | = | 8.8 | 8.8 | 14 | 4 | Binding affinity at human 5HT1F receptorBinding affinity at human 5HT1F receptor |
ChEMBL | 351 | 3 | 2 | 2 | 4.4 | CN1CCC(CC1)c1c[nH]c2c1cc(cc2)NC(=O)c1ccc(cc1)F | 10.1021/jm7011722 | ||
| 44352320 | 18951 | None | 0 | Human | Binding | pKi | = | 8.8 | 8.8 | - | 1 | Binding affinity towards human 5-hydroxytryptamine 1F receptorBinding affinity towards human 5-hydroxytryptamine 1F receptor |
ChEMBL | 351 | 3 | 2 | 2 | 4.4 | CN1CCC(c2c[nH]c3cccc(NC(=O)c4ccc(F)cc4)c23)CC1 | 10.1021/jm0155190 | ||
| CHEMBL128636 | 18951 | None | 0 | Human | Binding | pKi | = | 8.8 | 8.8 | - | 1 | Binding affinity towards human 5-hydroxytryptamine 1F receptorBinding affinity towards human 5-hydroxytryptamine 1F receptor |
ChEMBL | 351 | 3 | 2 | 2 | 4.4 | CN1CCC(c2c[nH]c3cccc(NC(=O)c4ccc(F)cc4)c23)CC1 | 10.1021/jm0155190 | ||
| 151 | 2416 | None | 39 | Human | Binding | pKi | = | 8.8 | 8.8 | 14 | 4 | In vitro binding affinity for human 5-hydroxytryptamine 1F receptorIn vitro binding affinity for human 5-hydroxytryptamine 1F receptor |
ChEMBL | 351 | 3 | 2 | 2 | 4.4 | CN1CCC(CC1)c1c[nH]c2c1cc(cc2)NC(=O)c1ccc(cc1)F | 10.1016/j.bmcl.2003.09.091 | ||
| 20 | 2416 | None | 39 | Human | Binding | pKi | = | 8.8 | 8.8 | 14 | 4 | In vitro binding affinity for human 5-hydroxytryptamine 1F receptorIn vitro binding affinity for human 5-hydroxytryptamine 1F receptor |
ChEMBL | 351 | 3 | 2 | 2 | 4.4 | CN1CCC(CC1)c1c[nH]c2c1cc(cc2)NC(=O)c1ccc(cc1)F | 10.1016/j.bmcl.2003.09.091 | ||
| 5311258 | 2416 | None | 39 | Human | Binding | pKi | = | 8.8 | 8.8 | 14 | 4 | In vitro binding affinity for human 5-hydroxytryptamine 1F receptorIn vitro binding affinity for human 5-hydroxytryptamine 1F receptor |
ChEMBL | 351 | 3 | 2 | 2 | 4.4 | CN1CCC(CC1)c1c[nH]c2c1cc(cc2)NC(=O)c1ccc(cc1)F | 10.1016/j.bmcl.2003.09.091 | ||
| CHEMBL101690 | 2416 | None | 39 | Human | Binding | pKi | = | 8.8 | 8.8 | 14 | 4 | In vitro binding affinity for human 5-hydroxytryptamine 1F receptorIn vitro binding affinity for human 5-hydroxytryptamine 1F receptor |
ChEMBL | 351 | 3 | 2 | 2 | 4.4 | CN1CCC(CC1)c1c[nH]c2c1cc(cc2)NC(=O)c1ccc(cc1)F | 10.1016/j.bmcl.2003.09.091 | ||
| 10220230 | 107478 | None | 0 | Human | Binding | pKi | = | 7 | 7.0 | 4 | 3 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 230 | 1 | 2 | 3 | 2.0 | CN1CCC(c2c[nH]c3ccc(N)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL318105 | 107478 | None | 0 | Human | Binding | pKi | = | 7 | 7.0 | 4 | 3 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 230 | 1 | 2 | 3 | 2.0 | CN1CCC(c2c[nH]c3ccc(N)nc23)CC1 | 10.1021/jm030020m | ||
| 10220244 | 107480 | None | 0 | Human | Binding | pKi | = | 7 | 7.0 | - | 1 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 231 | 1 | 2 | 3 | 2.1 | CN1CCC(c2c[nH]c3ccc(O)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL318110 | 107480 | None | 0 | Human | Binding | pKi | = | 7 | 7.0 | - | 1 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 231 | 1 | 2 | 3 | 2.1 | CN1CCC(c2c[nH]c3ccc(O)nc23)CC1 | 10.1021/jm030020m | ||
| 24865727 | 193222 | None | 0 | Human | Binding | pKi | = | 6 | 6.0 | -630 | 11 | Displacement of radioligand from human cloned 5HT1F receptorDisplacement of radioligand from human cloned 5HT1F receptor |
ChEMBL | 479 | 7 | 0 | 5 | 4.4 | Cc1ccc2c(OCCN3CCC(Cc4cccc(N5CCCS5(=O)=O)c4)CC3)cccc2n1 | 10.1021/jm8001444 | ||
| CHEMBL522708 | 193222 | None | 0 | Human | Binding | pKi | = | 6 | 6.0 | -630 | 11 | Displacement of radioligand from human cloned 5HT1F receptorDisplacement of radioligand from human cloned 5HT1F receptor |
ChEMBL | 479 | 7 | 0 | 5 | 4.4 | Cc1ccc2c(OCCN3CCC(Cc4cccc(N5CCCS5(=O)=O)c4)CC3)cccc2n1 | 10.1021/jm8001444 | ||
| 11810310 | 4720 | None | 0 | Human | Binding | pKi | = | 8.0 | 8.0 | 12 | 4 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 352 | 3 | 2 | 3 | 3.8 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4cccc(F)c4)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL103550 | 4720 | None | 0 | Human | Binding | pKi | = | 8.0 | 8.0 | 12 | 4 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 352 | 3 | 2 | 3 | 3.8 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4cccc(F)c4)nc23)CC1 | 10.1021/jm030020m | ||
| 10970604 | 5065 | None | 0 | Human | Binding | pKi | = | 8.0 | 8.0 | -3 | 3 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 367 | 3 | 3 | 3 | 4.2 | CN1CCC(c2c[nH]c3ccc(NC(=O)Nc4ccc(F)cc4)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL105369 | 5065 | None | 0 | Human | Binding | pKi | = | 8.0 | 8.0 | -3 | 3 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 367 | 3 | 3 | 3 | 4.2 | CN1CCC(c2c[nH]c3ccc(NC(=O)Nc4ccc(F)cc4)nc23)CC1 | 10.1021/jm030020m | ||
| 11727140 | 109449 | None | 0 | Human | Binding | pKi | = | 8.0 | 8.0 | 58 | 4 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 326 | 3 | 2 | 3 | 3.5 | CN1CCC(c2c[nH]c3ccc(NC(=O)C4CCCC4)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL321967 | 109449 | None | 0 | Human | Binding | pKi | = | 8.0 | 8.0 | 58 | 4 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 326 | 3 | 2 | 3 | 3.5 | CN1CCC(c2c[nH]c3ccc(NC(=O)C4CCCC4)nc23)CC1 | 10.1021/jm030020m | ||
| 10915350 | 163501 | None | 0 | Human | Binding | pKi | = | 8.0 | 8.0 | 9 | 3 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 359 | 3 | 2 | 4 | 3.5 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4cccc(C#N)c4)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL419547 | 163501 | None | 0 | Human | Binding | pKi | = | 8.0 | 8.0 | 9 | 3 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 359 | 3 | 2 | 4 | 3.5 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4cccc(C#N)c4)nc23)CC1 | 10.1021/jm030020m | ||
| 122190357 | 123544 | None | 0 | Human | Binding | pKi | = | 6.0 | 6.0 | - | 1 | Binding affinity to human 5HT1F receptor by radioligand binding assayBinding affinity to human 5HT1F receptor by radioligand binding assay |
ChEMBL | 356 | 4 | 2 | 4 | 3.3 | CN1CCC(C(=O)c2cccc(NC(=O)c3ccc(F)cc3)c2O)CC1 | 10.1016/j.bmcl.2015.07.042 | ||
| CHEMBL3617556 | 123544 | None | 0 | Human | Binding | pKi | = | 6.0 | 6.0 | - | 1 | Binding affinity to human 5HT1F receptor by radioligand binding assayBinding affinity to human 5HT1F receptor by radioligand binding assay |
ChEMBL | 356 | 4 | 2 | 4 | 3.3 | CN1CCC(C(=O)c2cccc(NC(=O)c3ccc(F)cc3)c2O)CC1 | 10.1016/j.bmcl.2015.07.042 | ||
| 44395894 | 66969 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | - | 1 | In vitro binding affinity for human 5-hydroxytryptamine 1F receptorIn vitro binding affinity for human 5-hydroxytryptamine 1F receptor |
ChEMBL | 371 | 3 | 1 | 4 | 4.2 | CN1CCC(c2noc3ccc(NC(=O)c4ccc(F)cc4F)cc23)CC1 | 10.1016/j.bmcl.2004.09.079 | ||
| CHEMBL186662 | 66969 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | - | 1 | In vitro binding affinity for human 5-hydroxytryptamine 1F receptorIn vitro binding affinity for human 5-hydroxytryptamine 1F receptor |
ChEMBL | 371 | 3 | 1 | 4 | 4.2 | CN1CCC(c2noc3ccc(NC(=O)c4ccc(F)cc4F)cc23)CC1 | 10.1016/j.bmcl.2004.09.079 | ||
| 11035452 | 5006 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | 8 | 4 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 348 | 3 | 2 | 3 | 3.9 | Cc1ccccc1C(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 | 10.1021/jm030020m | ||
| CHEMBL105025 | 5006 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | 8 | 4 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 348 | 3 | 2 | 3 | 3.9 | Cc1ccccc1C(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 | 10.1021/jm030020m | ||
| 11068036 | 163583 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | 2 | 2 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 348 | 3 | 2 | 3 | 3.9 | Cc1ccc(C(=O)Nc2ccc3[nH]cc(C4CCN(C)CC4)c3n2)cc1 | 10.1021/jm030020m | ||
| CHEMBL420101 | 163583 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | 2 | 2 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 348 | 3 | 2 | 3 | 3.9 | Cc1ccc(C(=O)Nc2ccc3[nH]cc(C4CCN(C)CC4)c3n2)cc1 | 10.1021/jm030020m | ||
| 11223004 | 204671 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | -4 | 5 | Inhibition of [3H]8-OH-DPAT binding to human 5-hydroxytryptamine 1F receptor expressed in CHO cellsInhibition of [3H]8-OH-DPAT binding to human 5-hydroxytryptamine 1F receptor expressed in CHO cells |
ChEMBL | 389 | 5 | 3 | 3 | 3.9 | O=S(=O)(Nc1ccc2[nH]cc(C[C@H]3CCCN3)c2c1)c1ccccc1Cl | 10.1021/jm049243i | ||
| CHEMBL609742 | 204671 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | -4 | 5 | Inhibition of [3H]8-OH-DPAT binding to human 5-hydroxytryptamine 1F receptor expressed in CHO cellsInhibition of [3H]8-OH-DPAT binding to human 5-hydroxytryptamine 1F receptor expressed in CHO cells |
ChEMBL | 389 | 5 | 3 | 3 | 3.9 | O=S(=O)(Nc1ccc2[nH]cc(C[C@H]3CCCN3)c2c1)c1ccccc1Cl | 10.1021/jm049243i | ||
| 44395930 | 67030 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | - | 1 | In vitro binding affinity for human 5-hydroxytryptamine 1F receptorIn vitro binding affinity for human 5-hydroxytryptamine 1F receptor |
ChEMBL | 388 | 3 | 2 | 4 | 4.0 | CN1CCC(N2CNc3ccc(NC(=O)c4ccc(F)cc4Cl)cc32)CC1 | 10.1016/j.bmcl.2004.09.079 | ||
| CHEMBL186951 | 67030 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | - | 1 | In vitro binding affinity for human 5-hydroxytryptamine 1F receptorIn vitro binding affinity for human 5-hydroxytryptamine 1F receptor |
ChEMBL | 388 | 3 | 2 | 4 | 4.0 | CN1CCC(N2CNc3ccc(NC(=O)c4ccc(F)cc4Cl)cc32)CC1 | 10.1016/j.bmcl.2004.09.079 | ||
| 10991087 | 4540 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | - | 1 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 328 | 6 | 2 | 3 | 3.9 | CCCCCC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 | 10.1021/jm030020m | ||
| CHEMBL102344 | 4540 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | - | 1 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 328 | 6 | 2 | 3 | 3.9 | CCCCCC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 | 10.1021/jm030020m | ||
| 10904295 | 4711 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | 1 | 4 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 352 | 3 | 2 | 3 | 3.8 | CN1CCC(c2c[nH]c3cnc(NC(=O)c4ccc(F)cc4)cc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL103503 | 4711 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | 1 | 4 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 352 | 3 | 2 | 3 | 3.8 | CN1CCC(c2c[nH]c3cnc(NC(=O)c4ccc(F)cc4)cc23)CC1 | 10.1021/jm030020m | ||
| 10925382 | 5018 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | 43 | 4 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 324 | 3 | 2 | 4 | 3.2 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccco4)nc23)CC1 | 10.1021/jm030020m | ||
| CHEMBL105091 | 5018 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | 43 | 4 | In vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptorIn vitro binding affinity was determined by radioligand binding assay using cell line expressing human 5-hydroxytryptamine 1F receptor |
ChEMBL | 324 | 3 | 2 | 4 | 3.2 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccco4)nc23)CC1 | 10.1021/jm030020m | ||
| 10991464 | 131889 | None | 0 | Human | Binding | pKi | = | 7.9 | 7.9 | - | 1 | In vitro binding affinity for human 5-hydroxytryptamine 1F receptorIn vitro binding affinity for human 5-hydroxytryptamine 1F receptor |
ChEMBL | 341 | 5 | 1 | 4 | 3.6 | Cc1oc2ccc(NC(=O)c3ccc(F)cc3)nc2c1CCN(C)C | 10.1016/j.bmcl.2003.09.091 | ||
Showing 1 to 50 of 1,023 entries