JNJ-42153605
SMILES | FC(c1c(ccn2c1nnc2CC1CC1)N1CCC(CC1)c1ccccc1)(F)F |
InChIKey | BQAVZGJJQFJSMW-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 0 |
Rotatable bonds | 4 |
Molecular weight (Da) | 400.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 7.82 | 7.82 | 7.82 | Guide to Pharmacology |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 7.82 | 7.82 | 7.82 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pEC50 | 7.77 | 7.77 | 7.77 | Guide to Pharmacology |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pEC50 | 6.42 | 7.36 | 8.32 | ChEMBL |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pIC50 | 7.82 | 7.82 | 7.82 | ChEMBL |