lorcaserin
| SMILES | Clc1ccc2c(c1)[C@@H](C)CNCC2 |
| InChIKey | XTTZERNUQAFMOF-QMMMGPOBSA-N |
Chemical properties
| Hydrogen bond acceptors | 1 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 0 |
| Molecular weight (Da) | 195.1 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | Yes |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| PAC1 | PACR | Human | VIP and PACAP | B1 | pKi | 7.966666666666666 | 7.97 | 7.97 | Guide to Pharmacology |
| VPAC1 | VIPR1 | Human | VIP and PACAP | B1 | pKi | 8.9 | 8.9 | 8.9 | Guide to Pharmacology |
| PAC1 | PACR | Rat | VIP and PACAP | B1 | pKi | 8.65 | 8.65 | 8.65 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| PAC1 | PACR | Human | VIP and PACAP | B1 | pEC50 | 8.883333333333333 | 8.88 | 8.88 | Guide to Pharmacology |
| PAC1 | PACR | Human | VIP and PACAP | B1 | pIC50 | 7.6 | 7.6 | 7.6 | Guide to Pharmacology |
| VPAC1 | VIPR1 | Human | VIP and PACAP | B1 | pIC50 | 8.15 | 8.15 | 8.15 | Guide to Pharmacology |
| VPAC1 | VIPR1 | Human | VIP and PACAP | B1 | pEC50 | 8.566666666666666 | 8.57 | 8.57 | Guide to Pharmacology |
| VPAC2 | VIPR2 | Human | VIP and PACAP | B1 | pEC50 | 8.466666666666667 | 8.47 | 8.47 | Guide to Pharmacology |
| VPAC2 | VIPR2 | Human | VIP and PACAP | B1 | pIC50 | 7.766666666666667 | 7.77 | 7.77 | Guide to Pharmacology |
| PAC1 | PACR | Rat | VIP and PACAP | B1 | pEC50 | 10.05 | 10.05 | 10.05 | Guide to Pharmacology |
| VPAC1 | VIPR1 | Rat | VIP and PACAP | B1 | pIC50 | 9.0 | 9.0 | 9.0 | Guide to Pharmacology |
| VPAC2 | VIPR2 | Rat | VIP and PACAP | B1 | pIC50 | 8.0 | 8.0 | 8.0 | Guide to Pharmacology |