lorcaserin
SMILES | Clc1ccc2c(c1)[C@@H](C)CNCC2 |
InChIKey | XTTZERNUQAFMOF-QMMMGPOBSA-N |
Chemical properties
Hydrogen bond acceptors | 1 |
Hydrogen bond donors | 1 |
Rotatable bonds | 0 |
Molecular weight (Da) | 195.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
PAC1 | PACR | Human | VIP and PACAP | B1 | pKi | 7.966666666666666 | 7.97 | 7.97 | Guide to Pharmacology |
VPAC1 | VIPR1 | Human | VIP and PACAP | B1 | pKi | 8.9 | 8.9 | 8.9 | Guide to Pharmacology |
PAC1 | PACR | Rat | VIP and PACAP | B1 | pKi | 8.65 | 8.65 | 8.65 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
PAC1 | PACR | Human | VIP and PACAP | B1 | pEC50 | 8.883333333333333 | 8.88 | 8.88 | Guide to Pharmacology |
PAC1 | PACR | Human | VIP and PACAP | B1 | pIC50 | 7.6 | 7.6 | 7.6 | Guide to Pharmacology |
VPAC1 | VIPR1 | Human | VIP and PACAP | B1 | pIC50 | 8.15 | 8.15 | 8.15 | Guide to Pharmacology |
VPAC1 | VIPR1 | Human | VIP and PACAP | B1 | pEC50 | 8.566666666666666 | 8.57 | 8.57 | Guide to Pharmacology |
VPAC2 | VIPR2 | Human | VIP and PACAP | B1 | pEC50 | 8.466666666666667 | 8.47 | 8.47 | Guide to Pharmacology |
VPAC2 | VIPR2 | Human | VIP and PACAP | B1 | pIC50 | 7.766666666666667 | 7.77 | 7.77 | Guide to Pharmacology |
PAC1 | PACR | Rat | VIP and PACAP | B1 | pEC50 | 10.05 | 10.05 | 10.05 | Guide to Pharmacology |
VPAC1 | VIPR1 | Rat | VIP and PACAP | B1 | pIC50 | 9.0 | 9.0 | 9.0 | Guide to Pharmacology |
VPAC2 | VIPR2 | Rat | VIP and PACAP | B1 | pIC50 | 8.0 | 8.0 | 8.0 | Guide to Pharmacology |